C26H27F4N3O3S — CID 178179875
(1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-[(1-fluorocyclopropyl)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 178179875) has the molecular formula C26H27F4N3O3S and a molecular weight of 537.58 g/mol. Its IUPAC name is (1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-[(1-fluorocyclopropyl)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-[(1-fluorocyclopropyl)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 178179875 |
| Molecular Formula | C26H27F4N3O3S |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | (1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-[(1-fluorocyclopropyl)methyl]-2-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | O=C(NCC1(F)CC1)N1[C@@H]2C[C@@H]2[C@@H](NS(=O)(=O)C2CC2)[C@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C26H27F4N3O3S/c27-16-8-15(9-17(28)11-16)19-3-1-2-14(23(19)29)10-22-24(32-37(35,36)18-4-5-18)20-12-21(20)33(22)25(34)31-13-26(30)6-7-26/h1-3,8-9,11,18,20-22,24,32H,4-7,10,12-13H2,(H,31,34)/t20-,21+,22+,24+/m0/s1 |
| InChIKey | SMHHTCHMMZXACP-JVNMPXIPSA-N |
| XLogP | 4.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |