C25H28F3N3O3S — CID 178179935
(1R,3R,4R,5S)-2-(cyclobutanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(dimethylsulfamoylamino)-2-azabicyclo[3.1.0]hexane (PubChem CID 178179935) has the molecular formula C25H28F3N3O3S and a molecular weight of 507.58 g/mol. Its IUPAC name is (1R,3R,4R,5S)-2-(cyclobutanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(dimethylsulfamoylamino)-2-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,3R,4R,5S)-2-(cyclobutanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(dimethylsulfamoylamino)-2-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 178179935 |
| Molecular Formula | C25H28F3N3O3S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (1R,3R,4R,5S)-2-(cyclobutanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(dimethylsulfamoylamino)-2-azabicyclo[3.1.0]hexane |
| SMILES | CN(C)S(=O)(=O)N[C@@H]1[C@H]2C[C@H]2N(C(=O)C2CCC2)[C@@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C25H28F3N3O3S/c1-30(2)35(33,34)29-24-20-13-21(20)31(25(32)14-5-3-6-14)22(24)11-15-7-4-8-19(23(15)28)16-9-17(26)12-18(27)10-16/h4,7-10,12,14,20-22,24,29H,3,5-6,11,13H2,1-2H3/t20-,21+,22+,24+/m0/s1 |
| InChIKey | QHQOLMAYTFNPFZ-JVNMPXIPSA-N |
| XLogP | 3.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |