C24H25F3N2O4S — CID 178179927
N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-hydroxycyclobutanecarbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]methanesulfonamide (PubChem CID 178179927) has the molecular formula C24H25F3N2O4S and a molecular weight of 494.54 g/mol. Its IUPAC name is N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-hydroxycyclobutanecarbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]methanesulfonamide.
| Compound Name | N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-hydroxycyclobutanecarbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 178179927 |
| Molecular Formula | C24H25F3N2O4S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(1-hydroxycyclobutanecarbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1[C@H]2C[C@H]2N(C(=O)C2(O)CCC2)[C@@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C24H25F3N2O4S/c1-34(32,33)28-22-18-12-19(18)29(23(30)24(31)6-3-7-24)20(22)10-13-4-2-5-17(21(13)27)14-8-15(25)11-16(26)9-14/h2,4-5,8-9,11,18-20,22,28,31H,3,6-7,10,12H2,1H3/t18-,19+,20+,22+/m0/s1 |
| InChIKey | HFCQXLWGHWPTDZ-GPQLQYNLSA-N |
| XLogP | 2.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |