C24H26F3N3O4S — CID 178179914
N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(3-hydroxyazetidine-1-carbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide (PubChem CID 178179914) has the molecular formula C24H26F3N3O4S and a molecular weight of 509.55 g/mol. Its IUPAC name is N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(3-hydroxyazetidine-1-carbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide.
| Compound Name | N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(3-hydroxyazetidine-1-carbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 178179914 |
| Molecular Formula | C24H26F3N3O4S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[(1R,3R,4R,5S)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-(3-hydroxyazetidine-1-carbonyl)-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@@H]1[C@H]2C[C@H]2N(C(=O)N2CC(O)C2)[C@@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C24H26F3N3O4S/c1-2-35(33,34)28-23-19-10-20(19)30(24(32)29-11-17(31)12-29)21(23)8-13-4-3-5-18(22(13)27)14-6-15(25)9-16(26)7-14/h3-7,9,17,19-21,23,28,31H,2,8,10-12H2,1H3/t19-,20+,21+,23+/m0/s1 |
| InChIKey | YERBHMVNQZYDGF-ZZLPTCMGSA-N |
| XLogP | 2.49 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |