C24H26F3N3O3S — CID 178179939
(1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethyl-2-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 178179939) has the molecular formula C24H26F3N3O3S and a molecular weight of 493.55 g/mol. Its IUPAC name is (1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethyl-2-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethyl-2-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 178179939 |
| Molecular Formula | C24H26F3N3O3S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | (1R,3R,4R,5S)-4-(cyclopropylsulfonylamino)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-N-ethyl-2-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CCNC(=O)N1[C@@H]2C[C@@H]2[C@@H](NS(=O)(=O)C2CC2)[C@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C24H26F3N3O3S/c1-2-28-24(31)30-20-12-19(20)23(29-34(32,33)17-6-7-17)21(30)10-13-4-3-5-18(22(13)27)14-8-15(25)11-16(26)9-14/h3-5,8-9,11,17,19-21,23,29H,2,6-7,10,12H2,1H3,(H,28,31)/t19-,20+,21+,23+/m0/s1 |
| InChIKey | YZMFSCJIBMYIJF-ZZLPTCMGSA-N |
| XLogP | 3.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |