C23H24F5N3O3S — CID 178179867
(1S,3S,4S,5R)-N-(2,2-difluoroethyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(ethylsulfonylamino)-2-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 178179867) has the molecular formula C23H24F5N3O3S and a molecular weight of 517.52 g/mol. Its IUPAC name is (1S,3S,4S,5R)-N-(2,2-difluoroethyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(ethylsulfonylamino)-2-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1S,3S,4S,5R)-N-(2,2-difluoroethyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(ethylsulfonylamino)-2-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 178179867 |
| Molecular Formula | C23H24F5N3O3S |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (1S,3S,4S,5R)-N-(2,2-difluoroethyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-4-(ethylsulfonylamino)-2-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CCS(=O)(=O)N[C@H]1[C@@H]2C[C@@H]2N(C(=O)NCC(F)F)[C@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C23H24F5N3O3S/c1-2-35(33,34)30-22-17-10-18(17)31(23(32)29-11-20(26)27)19(22)8-12-4-3-5-16(21(12)28)13-6-14(24)9-15(25)7-13/h3-7,9,17-20,22,30H,2,8,10-11H2,1H3,(H,29,32)/t17-,18+,19+,22+/m1/s1 |
| InChIKey | COBCEQQYODWVRB-GHDARCQNSA-N |
| XLogP | 3.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |