C24H25F3N2O3S — CID 178179852
N-[(1R,3R,4R,5S)-2-(cyclopropanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide (PubChem CID 178179852) has the molecular formula C24H25F3N2O3S and a molecular weight of 478.54 g/mol. Its IUPAC name is N-[(1R,3R,4R,5S)-2-(cyclopropanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide.
| Compound Name | N-[(1R,3R,4R,5S)-2-(cyclopropanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 178179852 |
| Molecular Formula | C24H25F3N2O3S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-[(1R,3R,4R,5S)-2-(cyclopropanecarbonyl)-3-[[3-(3,5-difluorophenyl)-2-fluorophenyl]methyl]-2-azabicyclo[3.1.0]hexan-4-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@@H]1[C@H]2C[C@H]2N(C(=O)C2CC2)[C@@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1F |
| InChI | InChI=1S/C24H25F3N2O3S/c1-2-33(31,32)28-23-19-12-20(19)29(24(30)13-6-7-13)21(23)10-14-4-3-5-18(22(14)27)15-8-16(25)11-17(26)9-15/h3-5,8-9,11,13,19-21,23,28H,2,6-7,10,12H2,1H3/t19-,20+,21+,23+/m0/s1 |
| InChIKey | KOUKVOSSYUPTKN-ZZLPTCMGSA-N |
| XLogP | 3.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |