C22H30BrFN2O2S — CID 169173972
tert-butyl (7E)-6-[(3-bromo-2-fluorophenyl)methyl]-7-tert-butylsulfanylimino-5-azaspiro[2.4]heptane-5-carboxylate (PubChem CID 169173972) has the molecular formula C22H30BrFN2O2S and a molecular weight of 485.46 g/mol. Its IUPAC name is tert-butyl (7E)-6-[(3-bromo-2-fluorophenyl)methyl]-7-tert-butylsulfanylimino-5-azaspiro[2.4]heptane-5-carboxylate.
| Compound Name | tert-butyl (7E)-6-[(3-bromo-2-fluorophenyl)methyl]-7-tert-butylsulfanylimino-5-azaspiro[2.4]heptane-5-carboxylate |
|---|---|
| PubChem CID | 169173972 |
| Molecular Formula | C22H30BrFN2O2S |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | tert-butyl (7E)-6-[(3-bromo-2-fluorophenyl)methyl]-7-tert-butylsulfanylimino-5-azaspiro[2.4]heptane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)/C(=N\SC(C)(C)C)C1Cc1cccc(Br)c1F |
| InChI | InChI=1S/C22H30BrFN2O2S/c1-20(2,3)28-19(27)26-13-22(10-11-22)18(25-29-21(4,5)6)16(26)12-14-8-7-9-15(23)17(14)24/h7-9,16H,10-13H2,1-6H3/b25-18- |
| InChIKey | DWIYPBKJUPJDNR-BWAHOGKJSA-N |
| XLogP | 6.42 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|