C11H10O4 — CID 169174293
(2S)-2-ethenyl-5,7-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 169174293) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2S)-2-ethenyl-5,7-dihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-2-ethenyl-5,7-dihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 169174293 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (2S)-2-ethenyl-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | C=C[C@@H]1CC(=O)c2c(O)cc(O)cc2O1 |
| InChI | InChI=1S/C11H10O4/c1-2-7-5-9(14)11-8(13)3-6(12)4-10(11)15-7/h2-4,7,12-13H,1,5H2/t7-/m1/s1 |
| InChIKey | QHYVCDICJBSLCV-SSDOTTSWSA-N |
| XLogP | 1.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|