C20H23N5O6 — CID 169175124
2-methylpropyl N-[7-[(1S,3R,5S,6S)-3-cyano-2-hydroxy-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate (PubChem CID 169175124) has the molecular formula C20H23N5O6 and a molecular weight of 429.43 g/mol. Its IUPAC name is 2-methylpropyl N-[7-[(1S,3R,5S,6S)-3-cyano-2-hydroxy-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate.
| Compound Name | 2-methylpropyl N-[7-[(1S,3R,5S,6S)-3-cyano-2-hydroxy-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
|---|---|
| PubChem CID | 169175124 |
| Molecular Formula | C20H23N5O6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-methylpropyl N-[7-[(1S,3R,5S,6S)-3-cyano-2-hydroxy-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
| SMILES | CC(C)COC(=O)Nc1ncnn2c([C@@H]3O[C@]4(C#N)C(O)[C@@]45OC(C)(C)O[C@@H]35)ccc12 |
| InChI | InChI=1S/C20H23N5O6/c1-10(2)7-28-17(27)24-15-12-6-5-11(25(12)23-9-22-15)13-14-20(31-18(3,4)30-14)16(26)19(20,8-21)29-13/h5-6,9-10,13-14,16,26H,7H2,1-4H3,(H,22,23,24,27)/t13-,14-,16?,19+,20+/m0/s1 |
| InChIKey | CKRWCWLWFMVFDW-CLTAVJLMSA-N |
| XLogP | 1.53 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |