About ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid
ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid (PubChem CID 169177238) has the molecular formula C13H29NO3
and a molecular weight of 247.38 g/mol. Its IUPAC name is ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid |
| PubChem CID | 169177238 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid |
| SMILES | CC.CCN1CCC(C)C1.COCCC(=O)O |
| InChI | InChI=1S/C7H15N.C4H8O3.C2H6/c1-3-8-5-4-7(2)6-8;1-7-3-2-4(5)6;1-2/h7H,3-6H2,1-2H3;2-3H2,1H3,(H,5,6);1-2H3 |
| InChIKey | GDEAPRPQUHNEGP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid?
The IUPAC name of ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid (CID 169177238) is ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid.
What is the SMILES notation for ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid?
The canonical SMILES for ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid is CC.CCN1CCC(C)C1.COCCC(=O)O.
What is the InChIKey of ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid?
The InChIKey is GDEAPRPQUHNEGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C4H8O3.C2H6/c1-3-8-5-4-7(2)6-8;1-7-3-2-4(5)6;1-2/h7H,3-6H2,1-2H3;2-3H2,1H3,(H,5,6);1-2H3.
What are the key properties of ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid?
ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid has a molecular weight of 247.38 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-methylpyrrolidine;3-methoxypropanoic acid is sourced from PubChem (CID 169177238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).