silver;2,2,3,5-tetramethylhexanoic acid

C10H20AgO2 — CID 169177774

IUPACsilver;2,2,3,5-tetramethylhexanoic acid
SMILESCC(C)CC(C)C(C)(C)C(=O)O.[Ag]
InChIInChI=1S/C10H20O2.Ag/c1-7(2)6-8(3)10(4,5)9(11)12;/h7-8H,6H2,1-5H3,(H,11,12);
InChIKeyOHEZNLQEFUXHPY-UHFFFAOYSA-N
MW280.14 g/mol
LogP2.78
Rot. Bonds4

About silver;2,2,3,5-tetramethylhexanoic acid

silver;2,2,3,5-tetramethylhexanoic acid (PubChem CID 169177774) has the molecular formula C10H20AgO2 and a molecular weight of 280.14 g/mol. Its IUPAC name is silver;2,2,3,5-tetramethylhexanoic acid.

Molecular Properties

Compound Namesilver;2,2,3,5-tetramethylhexanoic acid
PubChem CID169177774
Molecular FormulaC10H20AgO2
Molecular Weight280.14 g/mol
Exact Mass279.05
IUPAC Namesilver;2,2,3,5-tetramethylhexanoic acid
SMILESCC(C)CC(C)C(C)(C)C(=O)O.[Ag]
InChIInChI=1S/C10H20O2.Ag/c1-7(2)6-8(3)10(4,5)9(11)12;/h7-8H,6H2,1-5H3,(H,11,12);
InChIKeyOHEZNLQEFUXHPY-UHFFFAOYSA-N
XLogP2.78
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.14
LogP ≤ 52.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze silver;2,2,3,5-tetramethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

magnesium;hydride;2,2,3-trimethylpentanoic acid
CID 175225022
2,3-dihydroxy-4,6-dimethyl-2-(4-methylpentan-2-yl)heptanoic acid
CID 139864246
4-methoxy-2,2,3-trimethylbutanoic acid
CID 79426196
azane;2,2,3-trimethylhexanedioic acid
CID 175059163
2,3,5-trimethylhexan-2-yl 2-methylpropanoate
CID 130218539
10-heptyl-2,2,3,5-tetramethyloctadecanoic acid
CID 175402032
2-hydroxy-3,5-dimethyl-2-propylhexanoic acid
CID 83051268
2-tert-butylperoxy-2-methylpropane;2,2,3-trimethylhexanoic acid
CID 146295425
2,2-dimethyl-3-sulfanylbutanoic acid
CID 87558354
5-(methoxymethyl)-2,2,3-trimethylundecanoic acid
CID 139489940
2,2-dimethyl-3-(4-methylpentan-2-yloxy)propanoic acid
CID 79622869
bis(2,2-bis(hydroxymethyl)propane-1,3-diol);2,2,3-trimethylbutanoic acid
CID 159916720

Frequently Asked Questions

What is the IUPAC name of silver;2,2,3,5-tetramethylhexanoic acid?
The IUPAC name of silver;2,2,3,5-tetramethylhexanoic acid (CID 169177774) is silver;2,2,3,5-tetramethylhexanoic acid.
What is the SMILES notation for silver;2,2,3,5-tetramethylhexanoic acid?
The canonical SMILES for silver;2,2,3,5-tetramethylhexanoic acid is CC(C)CC(C)C(C)(C)C(=O)O.[Ag].
What is the InChIKey of silver;2,2,3,5-tetramethylhexanoic acid?
The InChIKey is OHEZNLQEFUXHPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.Ag/c1-7(2)6-8(3)10(4,5)9(11)12;/h7-8H,6H2,1-5H3,(H,11,12);.
What are the key properties of silver;2,2,3,5-tetramethylhexanoic acid?
silver;2,2,3,5-tetramethylhexanoic acid has a molecular weight of 280.14 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for silver;2,2,3,5-tetramethylhexanoic acid is sourced from PubChem (CID 169177774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).