C25H20FN5O — CID 169178373
3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-N-benzyl-5-fluorobenzamide (PubChem CID 169178373) has the molecular formula C25H20FN5O and a molecular weight of 425.47 g/mol. Its IUPAC name is 3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-N-benzyl-5-fluorobenzamide.
| Compound Name | 3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-N-benzyl-5-fluorobenzamide |
|---|---|
| PubChem CID | 169178373 |
| Molecular Formula | C25H20FN5O |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-N-benzyl-5-fluorobenzamide |
| SMILES | Cn1cc(-c2cnc(N)c(C#Cc3cc(F)cc(C(=O)NCc4ccccc4)c3)c2)cn1 |
| InChI | InChI=1S/C25H20FN5O/c1-31-16-22(15-30-31)21-11-19(24(27)28-14-21)8-7-18-9-20(12-23(26)10-18)25(32)29-13-17-5-3-2-4-6-17/h2-6,9-12,14-16H,13H2,1H3,(H2,27,28)(H,29,32) |
| InChIKey | STAQJKNMAOLGJS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|