C23H18FN5OS — CID 169178399
3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-5-fluoro-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 169178399) has the molecular formula C23H18FN5OS and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-5-fluoro-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | 3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-5-fluoro-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 169178399 |
| Molecular Formula | C23H18FN5OS |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-[2-[2-amino-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-5-fluoro-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | Cn1cc(-c2cnc(N)c(C#Cc3cc(F)cc(C(=O)NCc4ccsc4)c3)c2)cn1 |
| InChI | InChI=1S/C23H18FN5OS/c1-29-13-20(12-28-29)19-8-17(22(25)26-11-19)3-2-15-6-18(9-21(24)7-15)23(30)27-10-16-4-5-31-14-16/h4-9,11-14H,10H2,1H3,(H2,25,26)(H,27,30) |
| InChIKey | MKQUUZATCNGMIV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|