C21H28FNOSi — CID 169182054
(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethanamine (PubChem CID 169182054) has the molecular formula C21H28FNOSi and a molecular weight of 357.55 g/mol. Its IUPAC name is (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethanamine.
| Compound Name | (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethanamine |
|---|---|
| PubChem CID | 169182054 |
| Molecular Formula | C21H28FNOSi |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-(1-fluorocyclopropyl)ethanamine |
| SMILES | CC(C)(C)[Si](OC[C@@H](N)C1(F)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28FNOSi/c1-20(2,3)25(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24-16-19(23)21(22)14-15-21/h4-13,19H,14-16,23H2,1-3H3/t19-/m1/s1 |
| InChIKey | BCJVTEWVCJXPFU-LJQANCHMSA-N |
| XLogP | 3.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|