C32H30F3N5O4 — CID 169182342
7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-(oxan-3-ylamino)-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 169182342) has the molecular formula C32H30F3N5O4 and a molecular weight of 605.62 g/mol. Its IUPAC name is 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-(oxan-3-ylamino)-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-(oxan-3-ylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 169182342 |
| Molecular Formula | C32H30F3N5O4 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-(oxan-3-ylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3[nH]c(=O)c4c(NC5CCCOC5)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C32H30F3N5O4/c1-2-21-23(34)7-6-17-11-20(41)12-22(24(17)21)27-26(35)28-25(30(42)37-27)29(36-19-5-3-10-43-15-19)39-31(38-28)44-16-32-8-4-9-40(32)14-18(33)13-32/h1,6-7,11-12,18-19,41H,3-5,8-10,13-16H2,(H,37,42)(H,36,38,39)/t18-,19?,32+/m1/s1 |
| InChIKey | SRBTVEUUSSPMCI-HCLZWVAGSA-N |
| XLogP | 4.65 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|