C39H56N6O — CID 169183242
[3-[5-[(Z)-1-[4-(diazinan-1-ylmethyl)hex-5-en-2-ylideneamino]prop-1-enyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-2-yl]-2-pyridinyl]-methoxymethanamine (PubChem CID 169183242) has the molecular formula C39H56N6O and a molecular weight of 624.92 g/mol. Its IUPAC name is [3-[5-[(Z)-1-[4-(diazinan-1-ylmethyl)hex-5-en-2-ylideneamino]prop-1-enyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-2-yl]-2-pyridinyl]-methoxymethanamine.
| Compound Name | [3-[5-[(Z)-1-[4-(diazinan-1-ylmethyl)hex-5-en-2-ylideneamino]prop-1-enyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-2-yl]-2-pyridinyl]-methoxymethanamine |
|---|---|
| PubChem CID | 169183242 |
| Molecular Formula | C39H56N6O |
| Molecular Weight | 624.92 g/mol |
| Exact Mass | 624.45 |
| IUPAC Name | [3-[5-[(Z)-1-[4-(diazinan-1-ylmethyl)hex-5-en-2-ylideneamino]prop-1-enyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-2-yl]-2-pyridinyl]-methoxymethanamine |
| SMILES | C=CCCC(C)(C)Cc1c(-c2cccnc2C(N)OC)n(CC)c2ccc(C(=C/C)/N=C(\C)CC(C=C)CN3CCCCN3)cc12 |
| InChI | InChI=1S/C39H56N6O/c1-9-13-20-39(6,7)26-33-32-25-30(34(11-3)43-28(5)24-29(10-2)27-44-23-15-14-22-42-44)18-19-35(32)45(12-4)37(33)31-17-16-21-41-36(31)38(40)46-8/h9-11,16-19,21,25,29,38,42H,1-2,12-15,20,22-24,26-27,40H2,3-8H3/b34-11-,43-28+ |
| InChIKey | ABKPTZSZWYYNIG-OTQQNEFISA-N |
| XLogP | 8.48 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.92 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|