C37H47N3O — CID 166144448
3-[2-[2-(1-aminopropyl)-3-pyridinyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-5-yl]-5-(2-methylbut-3-enyl)phenol (PubChem CID 166144448) has the molecular formula C37H47N3O and a molecular weight of 549.80 g/mol. Its IUPAC name is 3-[2-[2-(1-aminopropyl)-3-pyridinyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-5-yl]-5-(2-methylbut-3-enyl)phenol.
| Compound Name | 3-[2-[2-(1-aminopropyl)-3-pyridinyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-5-yl]-5-(2-methylbut-3-enyl)phenol |
|---|---|
| PubChem CID | 166144448 |
| Molecular Formula | C37H47N3O |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.37 |
| IUPAC Name | 3-[2-[2-(1-aminopropyl)-3-pyridinyl]-3-(2,2-dimethylhex-5-enyl)-1-ethylindol-5-yl]-5-(2-methylbut-3-enyl)phenol |
| SMILES | C=CCCC(C)(C)Cc1c(-c2cccnc2C(N)CC)n(CC)c2ccc(-c3cc(O)cc(CC(C)C=C)c3)cc12 |
| InChI | InChI=1S/C37H47N3O/c1-8-12-17-37(6,7)24-32-31-23-27(28-20-26(19-25(5)9-2)21-29(41)22-28)15-16-34(31)40(11-4)36(32)30-14-13-18-39-35(30)33(38)10-3/h8-9,13-16,18,20-23,25,33,41H,1-2,10-12,17,19,24,38H2,3-7H3 |
| InChIKey | CKLJARQTGAUTHK-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|