C36H44N2O5 — CID 166115835
[3-[1-ethyl-5-[3-hydroxy-5-(7-oxoheptyl)phenyl]-2-[2-(methoxymethyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate (PubChem CID 166115835) has the molecular formula C36H44N2O5 and a molecular weight of 584.76 g/mol. Its IUPAC name is [3-[1-ethyl-5-[3-hydroxy-5-(7-oxoheptyl)phenyl]-2-[2-(methoxymethyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate.
| Compound Name | [3-[1-ethyl-5-[3-hydroxy-5-(7-oxoheptyl)phenyl]-2-[2-(methoxymethyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate |
|---|---|
| PubChem CID | 166115835 |
| Molecular Formula | C36H44N2O5 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | [3-[1-ethyl-5-[3-hydroxy-5-(7-oxoheptyl)phenyl]-2-[2-(methoxymethyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate |
| SMILES | CCn1c(-c2cccnc2COC)c(CC(C)(C)COC=O)c2cc(-c3cc(O)cc(CCCCCCC=O)c3)ccc21 |
| InChI | InChI=1S/C36H44N2O5/c1-5-38-34-15-14-27(28-18-26(19-29(41)20-28)12-9-7-6-8-10-17-39)21-31(34)32(22-36(2,3)24-43-25-40)35(38)30-13-11-16-37-33(30)23-42-4/h11,13-21,25,41H,5-10,12,22-24H2,1-4H3 |
| InChIKey | KIVHXLMNOKIPAK-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|