C37H51N5O5 — CID 169183579
[3-[1-ethyl-5-[3-[6-[formamido(methyl)amino]hexyl]-5-hydroxyphenyl]-2-[(E)-3-methoxy-2-(prop-2-enylideneamino)but-1-enyl]indol-3-yl]-2,2-dimethylpropyl] nitrite (PubChem CID 169183579) has the molecular formula C37H51N5O5 and a molecular weight of 645.85 g/mol. Its IUPAC name is [3-[1-ethyl-5-[3-[6-[formamido(methyl)amino]hexyl]-5-hydroxyphenyl]-2-[(E)-3-methoxy-2-(prop-2-enylideneamino)but-1-enyl]indol-3-yl]-2,2-dimethylpropyl] nitrite.
| Compound Name | [3-[1-ethyl-5-[3-[6-[formamido(methyl)amino]hexyl]-5-hydroxyphenyl]-2-[(E)-3-methoxy-2-(prop-2-enylideneamino)but-1-enyl]indol-3-yl]-2,2-dimethylpropyl] nitrite |
|---|---|
| PubChem CID | 169183579 |
| Molecular Formula | C37H51N5O5 |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.39 |
| IUPAC Name | [3-[1-ethyl-5-[3-[6-[formamido(methyl)amino]hexyl]-5-hydroxyphenyl]-2-[(E)-3-methoxy-2-(prop-2-enylideneamino)but-1-enyl]indol-3-yl]-2,2-dimethylpropyl] nitrite |
| SMILES | C=C/C=N/C(=C/c1c(CC(C)(C)CON=O)c2cc(-c3cc(O)cc(CCCCCCN(C)NC=O)c3)ccc2n1CC)C(C)OC |
| InChI | InChI=1S/C37H51N5O5/c1-8-17-38-34(27(3)46-7)23-36-33(24-37(4,5)25-47-40-45)32-22-29(15-16-35(32)42(36)9-2)30-19-28(20-31(44)21-30)14-12-10-11-13-18-41(6)39-26-43/h8,15-17,19-23,26-27,44H,1,9-14,18,24-25H2,2-7H3,(H,39,43)/b34-23+,38-17+ |
| InChIKey | GISZEFIJRFARBR-XKDWHZCWSA-N |
| XLogP | 7.63 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|