C42H59N5O5 — CID 166115653
acetonitrile;ethane;[3-[1-ethyl-5-[3-(7-hydrazinyl-3-oxoheptyl)-5-hydroxyphenyl]-2-[2-(1-methoxypropyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate (PubChem CID 166115653) has the molecular formula C42H59N5O5 and a molecular weight of 713.96 g/mol. Its IUPAC name is acetonitrile;ethane;[3-[1-ethyl-5-[3-(7-hydrazinyl-3-oxoheptyl)-5-hydroxyphenyl]-2-[2-(1-methoxypropyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate.
| Compound Name | acetonitrile;ethane;[3-[1-ethyl-5-[3-(7-hydrazinyl-3-oxoheptyl)-5-hydroxyphenyl]-2-[2-(1-methoxypropyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate |
|---|---|
| PubChem CID | 166115653 |
| Molecular Formula | C42H59N5O5 |
| Molecular Weight | 713.96 g/mol |
| Exact Mass | 713.45 |
| IUPAC Name | acetonitrile;ethane;[3-[1-ethyl-5-[3-(7-hydrazinyl-3-oxoheptyl)-5-hydroxyphenyl]-2-[2-(1-methoxypropyl)-3-pyridinyl]indol-3-yl]-2,2-dimethylpropyl] formate |
| SMILES | CC.CC#N.CCC(OC)c1ncccc1-c1c(CC(C)(C)COC=O)c2cc(-c3cc(O)cc(CCC(=O)CCCCNN)c3)ccc2n1CC |
| InChI | InChI=1S/C38H50N4O5.C2H3N.C2H6/c1-6-35(46-5)36-31(12-10-17-40-36)37-33(23-38(3,4)24-47-25-43)32-22-27(14-16-34(32)42(37)7-2)28-19-26(20-30(45)21-28)13-15-29(44)11-8-9-18-41-39;1-2-3;1-2/h10,12,14,16-17,19-22,25,35,41,45H,6-9,11,13,15,18,23-24,39H2,1-5H3;1H3;1-2H3 |
| InChIKey | QQGSHDXVMKOJJQ-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 152.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.96 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|