C38H49NO4 — CID 156736573
7-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(2-methoxyethyl)phenyl]indol-5-yl]-5-hydroxyphenyl]-2-methylheptanal (PubChem CID 156736573) has the molecular formula C38H49NO4 and a molecular weight of 583.81 g/mol. Its IUPAC name is 7-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(2-methoxyethyl)phenyl]indol-5-yl]-5-hydroxyphenyl]-2-methylheptanal.
| Compound Name | 7-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(2-methoxyethyl)phenyl]indol-5-yl]-5-hydroxyphenyl]-2-methylheptanal |
|---|---|
| PubChem CID | 156736573 |
| Molecular Formula | C38H49NO4 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.37 |
| IUPAC Name | 7-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(2-methoxyethyl)phenyl]indol-5-yl]-5-hydroxyphenyl]-2-methylheptanal |
| SMILES | CCn1c(-c2ccccc2CCOC)c(CC(C)(C)CO)c2cc(-c3cc(O)cc(CCCCCC(C)C=O)c3)ccc21 |
| InChI | InChI=1S/C38H49NO4/c1-6-39-36-17-16-30(31-20-28(21-32(42)22-31)13-9-7-8-12-27(2)25-40)23-34(36)35(24-38(3,4)26-41)37(39)33-15-11-10-14-29(33)18-19-43-5/h10-11,14-17,20-23,25,27,41-42H,6-9,12-13,18-19,24,26H2,1-5H3 |
| InChIKey | WBTDSKOVOSRWPK-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|