C36H45N3 — CID 166144353
1-[3-[1-ethyl-2-(2-ethyl-3-pyridinyl)-3-(2,2,5-trimethylhex-5-enyl)indol-5-yl]phenyl]but-3-en-2-amine (PubChem CID 166144353) has the molecular formula C36H45N3 and a molecular weight of 519.78 g/mol. Its IUPAC name is 1-[3-[1-ethyl-2-(2-ethyl-3-pyridinyl)-3-(2,2,5-trimethylhex-5-enyl)indol-5-yl]phenyl]but-3-en-2-amine.
| Compound Name | 1-[3-[1-ethyl-2-(2-ethyl-3-pyridinyl)-3-(2,2,5-trimethylhex-5-enyl)indol-5-yl]phenyl]but-3-en-2-amine |
|---|---|
| PubChem CID | 166144353 |
| Molecular Formula | C36H45N3 |
| Molecular Weight | 519.78 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | 1-[3-[1-ethyl-2-(2-ethyl-3-pyridinyl)-3-(2,2,5-trimethylhex-5-enyl)indol-5-yl]phenyl]but-3-en-2-amine |
| SMILES | C=CC(N)Cc1cccc(-c2ccc3c(c2)c(CC(C)(C)CCC(=C)C)c(-c2cccnc2CC)n3CC)c1 |
| InChI | InChI=1S/C36H45N3/c1-8-29(37)22-26-13-11-14-27(21-26)28-16-17-34-31(23-28)32(24-36(6,7)19-18-25(4)5)35(39(34)10-3)30-15-12-20-38-33(30)9-2/h8,11-17,20-21,23,29H,1,4,9-10,18-19,22,24,37H2,2-3,5-7H3 |
| InChIKey | IFUOTKXHGPBPQW-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.78 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|