C30H37N9 — CID 169186870
7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(pyrrolidin-3-ylmethyl)-1H-1,2,4,6-tetrazonine-5,7-diamine (PubChem CID 169186870) has the molecular formula C30H37N9 and a molecular weight of 523.69 g/mol. Its IUPAC name is 7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(pyrrolidin-3-ylmethyl)-1H-1,2,4,6-tetrazonine-5,7-diamine.
| Compound Name | 7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(pyrrolidin-3-ylmethyl)-1H-1,2,4,6-tetrazonine-5,7-diamine |
|---|---|
| PubChem CID | 169186870 |
| Molecular Formula | C30H37N9 |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(pyrrolidin-3-ylmethyl)-1H-1,2,4,6-tetrazonine-5,7-diamine |
| SMILES | CNc1ccc2c(-c3ccccc3CNc3nc(NCC4CCNC4)ncn[nH]cc3C(C)C)nccc2c1 |
| InChI | InChI=1S/C30H37N9/c1-20(2)27-18-37-38-19-36-30(35-16-21-10-12-32-15-21)39-29(27)34-17-23-6-4-5-7-25(23)28-26-9-8-24(31-3)14-22(26)11-13-33-28/h4-9,11,13-14,18-21,31-32,37H,10,12,15-17H2,1-3H3,(H2,34,35,36,38,39)/b27-18- |
| InChIKey | RMSPSEYEZVTLPN-IMRQLAEWSA-N |
| XLogP | 5.34 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |