C36H47N9OS — CID 169186973
(E)-4-(dimethylamino)but-2-enal;7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(thian-4-yl)-1H-1,2,4,6-tetrazonine-5,7-diamine (PubChem CID 169186973) has the molecular formula C36H47N9OS and a molecular weight of 653.90 g/mol. Its IUPAC name is (E)-4-(dimethylamino)but-2-enal;7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(thian-4-yl)-1H-1,2,4,6-tetrazonine-5,7-diamine.
| Compound Name | (E)-4-(dimethylamino)but-2-enal;7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(thian-4-yl)-1H-1,2,4,6-tetrazonine-5,7-diamine |
|---|---|
| PubChem CID | 169186973 |
| Molecular Formula | C36H47N9OS |
| Molecular Weight | 653.90 g/mol |
| Exact Mass | 653.36 |
| IUPAC Name | (E)-4-(dimethylamino)but-2-enal;7-N-[[2-[6-(methylamino)isoquinolin-1-yl]phenyl]methyl]-8-propan-2-yl-5-N-(thian-4-yl)-1H-1,2,4,6-tetrazonine-5,7-diamine |
| SMILES | CN(C)C/C=C/C=O.CNc1ccc2c(-c3ccccc3CNc3nc(NC4CCSCC4)ncn[nH]cc3C(C)C)nccc2c1 |
| InChI | InChI=1S/C30H36N8S.C6H11NO/c1-20(2)27-18-35-36-19-34-30(37-23-11-14-39-15-12-23)38-29(27)33-17-22-6-4-5-7-25(22)28-26-9-8-24(31-3)16-21(26)10-13-32-28;1-7(2)5-3-4-6-8/h4-10,13,16,18-20,23,31,35H,11-12,14-15,17H2,1-3H3,(H2,33,34,36,37,38);3-4,6H,5H2,1-2H3/b27-18-;4-3+ |
| InChIKey | IFLCQULFTQUSPB-ZQYVOIGPSA-N |
| XLogP | 6.93 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.90 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|