C20H26N4O3S — CID 169187475
1-(cyclopropylmethyl)-3-(2-methylazetidin-3-yl)-6-[(1-methylcyclopropyl)amino]sulfanyloxyquinazoline-2,4-dione (PubChem CID 169187475) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-(2-methylazetidin-3-yl)-6-[(1-methylcyclopropyl)amino]sulfanyloxyquinazoline-2,4-dione.
| Compound Name | 1-(cyclopropylmethyl)-3-(2-methylazetidin-3-yl)-6-[(1-methylcyclopropyl)amino]sulfanyloxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 169187475 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-(2-methylazetidin-3-yl)-6-[(1-methylcyclopropyl)amino]sulfanyloxyquinazoline-2,4-dione |
| SMILES | CC1NCC1n1c(=O)c2cc(OSNC3(C)CC3)ccc2n(CC2CC2)c1=O |
| InChI | InChI=1S/C20H26N4O3S/c1-12-17(10-21-12)24-18(25)15-9-14(27-28-22-20(2)7-8-20)5-6-16(15)23(19(24)26)11-13-3-4-13/h5-6,9,12-13,17,21-22H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | BWERKPNHSYWEQW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|