C25H29N5O5S2 — CID 169187521
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-methylcyclopropyl)amino]sulfanyl-3-(1-prop-2-enoylazetidin-3-yl)quinazoline-2,4-dione;formic acid (PubChem CID 169187521) has the molecular formula C25H29N5O5S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-methylcyclopropyl)amino]sulfanyl-3-(1-prop-2-enoylazetidin-3-yl)quinazoline-2,4-dione;formic acid.
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-methylcyclopropyl)amino]sulfanyl-3-(1-prop-2-enoylazetidin-3-yl)quinazoline-2,4-dione;formic acid |
|---|---|
| PubChem CID | 169187521 |
| Molecular Formula | C25H29N5O5S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-6-[(1-methylcyclopropyl)amino]sulfanyl-3-(1-prop-2-enoylazetidin-3-yl)quinazoline-2,4-dione;formic acid |
| SMILES | C=CC(=O)N1CC(n2c(=O)c3cc(SNC4(C)CC4)ccc3n(Cc3sc(C)nc3C)c2=O)C1.O=CO |
| InChI | InChI=1S/C24H27N5O3S2.CH2O2/c1-5-21(30)27-11-16(12-27)29-22(31)18-10-17(34-26-24(4)8-9-24)6-7-19(18)28(23(29)32)13-20-14(2)25-15(3)33-20;2-1-3/h5-7,10,16,26H,1,8-9,11-13H2,2-4H3;1H,(H,2,3) |
| InChIKey | ZHWOOSWXKAYHIW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|