About CID 169187680
CID 169187680 (PubChem CID 169187680) has the molecular formula C7H15BO2
and a molecular weight of 142.01 g/mol.
Molecular Properties
| Compound Name | CID 169187680 |
| PubChem CID | 169187680 |
| Molecular Formula | C7H15BO2 |
| Molecular Weight | 142.01 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | — |
| SMILES | CC.[B]C1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C5H9BO2.C2H6/c6-5-2-1-4(3-7)8-5;1-2/h4-5,7H,1-3H2;1-2H3/t4-,5?;/m0./s1 |
| InChIKey | SSJOKIDZLSYXRM-PHHGQXFYSA-N |
| XLogP | 0.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.01 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169187680 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169187680?
The IUPAC name of CID 169187680 (CID 169187680) is not available.
What is the SMILES notation for CID 169187680?
The canonical SMILES for CID 169187680 is CC.[B]C1CC[C@@H](CO)O1.
What is the InChIKey of CID 169187680?
The InChIKey is SSJOKIDZLSYXRM-PHHGQXFYSA-N. The full InChI is InChI=1S/C5H9BO2.C2H6/c6-5-2-1-4(3-7)8-5;1-2/h4-5,7H,1-3H2;1-2H3/t4-,5?;/m0./s1.
What are the key properties of CID 169187680?
CID 169187680 has a molecular weight of 142.01 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169187680 is sourced from PubChem (CID 169187680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).