C20H21ClN2O2S — CID 16918926
N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-ethylsulfanylbenzamide (PubChem CID 16918926) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-ethylsulfanylbenzamide.
| Compound Name | N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 16918926 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]methyl]-2-ethylsulfanylbenzamide |
| SMILES | CCSc1ccccc1C(=O)NCC1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H21ClN2O2S/c1-2-26-18-6-4-3-5-17(18)20(25)22-12-14-11-19(24)23(13-14)16-9-7-15(21)8-10-16/h3-10,14H,2,11-13H2,1H3,(H,22,25) |
| InChIKey | QYPFPTQHOCJENI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |