C28H33N7O — CID 169189483
3-[4-[6-[5-(4-methylpiperazin-1-yl)-2,3-dihydro-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]propan-1-amine (PubChem CID 169189483) has the molecular formula C28H33N7O and a molecular weight of 483.62 g/mol. Its IUPAC name is 3-[4-[6-[5-(4-methylpiperazin-1-yl)-2,3-dihydro-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]propan-1-amine.
| Compound Name | 3-[4-[6-[5-(4-methylpiperazin-1-yl)-2,3-dihydro-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 169189483 |
| Molecular Formula | C28H33N7O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 3-[4-[6-[5-(4-methylpiperazin-1-yl)-2,3-dihydro-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]propan-1-amine |
| SMILES | CN1CCN(c2ccc3c(c2)NC(c2ccc4nc(-c5ccc(OCCCN)cc5)[nH]c4c2)N3)CC1 |
| InChI | InChI=1S/C28H33N7O/c1-34-12-14-35(15-13-34)21-6-10-24-26(18-21)33-28(31-24)20-5-9-23-25(17-20)32-27(30-23)19-3-7-22(8-4-19)36-16-2-11-29/h3-10,17-18,28,31,33H,2,11-16,29H2,1H3,(H,30,32) |
| InChIKey | QEEPTPUBMFELFP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|