C28H29FN8O4 — CID 169191538
3-cyclopentyl-11-[3-fluoro-1-(trihydroxymethyl)pyrazol-4-yl]-5-methyl-12-(1-propan-2-ylindazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 169191538) has the molecular formula C28H29FN8O4 and a molecular weight of 560.59 g/mol. Its IUPAC name is 3-cyclopentyl-11-[3-fluoro-1-(trihydroxymethyl)pyrazol-4-yl]-5-methyl-12-(1-propan-2-ylindazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-cyclopentyl-11-[3-fluoro-1-(trihydroxymethyl)pyrazol-4-yl]-5-methyl-12-(1-propan-2-ylindazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 169191538 |
| Molecular Formula | C28H29FN8O4 |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 3-cyclopentyl-11-[3-fluoro-1-(trihydroxymethyl)pyrazol-4-yl]-5-methyl-12-(1-propan-2-ylindazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | CC(C)n1ncc2cc(-c3c(-c4cn(C(O)(O)O)nc4F)[nH]c4ncc5c(c34)n(C3CCCC3)c(=O)n5C)ccc21 |
| InChI | InChI=1S/C28H29FN8O4/c1-14(2)37-19-9-8-15(10-16(19)11-31-37)21-22-24-20(34(3)27(38)36(24)17-6-4-5-7-17)12-30-26(22)32-23(21)18-13-35(28(39,40)41)33-25(18)29/h8-14,17,39-41H,4-7H2,1-3H3,(H,30,32) |
| InChIKey | MRCQTIDTXPRZJL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|