C29H30FN5O3 — CID 177039250
3-cyclopentyl-11-(2-fluoro-5-methyl-3-pyridinyl)-12-[4-(2-hydroxypropoxy)phenyl]-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 177039250) has the molecular formula C29H30FN5O3 and a molecular weight of 515.59 g/mol. Its IUPAC name is 3-cyclopentyl-11-(2-fluoro-5-methyl-3-pyridinyl)-12-[4-(2-hydroxypropoxy)phenyl]-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-cyclopentyl-11-(2-fluoro-5-methyl-3-pyridinyl)-12-[4-(2-hydroxypropoxy)phenyl]-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 177039250 |
| Molecular Formula | C29H30FN5O3 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 3-cyclopentyl-11-(2-fluoro-5-methyl-3-pyridinyl)-12-[4-(2-hydroxypropoxy)phenyl]-5-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | Cc1cnc(F)c(-c2[nH]c3ncc4c(c3c2-c2ccc(OCC(C)O)cc2)n(C2CCCC2)c(=O)n4C)c1 |
| InChI | InChI=1S/C29H30FN5O3/c1-16-12-21(27(30)31-13-16)25-23(18-8-10-20(11-9-18)38-15-17(2)36)24-26-22(14-32-28(24)33-25)34(3)29(37)35(26)19-6-4-5-7-19/h8-14,17,19,36H,4-7,15H2,1-3H3,(H,32,33) |
| InChIKey | WOICSMQDOWONFJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|