C28H29N7O — CID 167085382
3-cyclopentyl-5-methyl-12-[3-methyl-4-[methyl-(methylideneamino)amino]phenyl]-11-pyridin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 167085382) has the molecular formula C28H29N7O and a molecular weight of 479.59 g/mol. Its IUPAC name is 3-cyclopentyl-5-methyl-12-[3-methyl-4-[methyl-(methylideneamino)amino]phenyl]-11-pyridin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-cyclopentyl-5-methyl-12-[3-methyl-4-[methyl-(methylideneamino)amino]phenyl]-11-pyridin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 167085382 |
| Molecular Formula | C28H29N7O |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3-cyclopentyl-5-methyl-12-[3-methyl-4-[methyl-(methylideneamino)amino]phenyl]-11-pyridin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | C=NN(C)c1ccc(-c2c(-c3cccnc3)[nH]c3ncc4c(c23)n(C2CCCC2)c(=O)n4C)cc1C |
| InChI | InChI=1S/C28H29N7O/c1-17-14-18(11-12-21(17)34(4)29-2)23-24-26-22(33(3)28(36)35(26)20-9-5-6-10-20)16-31-27(24)32-25(23)19-8-7-13-30-15-19/h7-8,11-16,20H,2,5-6,9-10H2,1,3-4H3,(H,31,32) |
| InChIKey | LVOFCCLLGNBVBU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 84.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|