C23H25ClN4O4 — CID 169192830
3-[[1-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid (PubChem CID 169192830) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is 3-[[1-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid.
| Compound Name | 3-[[1-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 169192830 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[[1-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-5-yl]methylamino]propanoic acid |
| SMILES | CC(C)Oc1ccc(-c2nc(N3CCc4cc(CNCCC(=O)O)ccc43)no2)cc1Cl |
| InChI | InChI=1S/C23H25ClN4O4/c1-14(2)31-20-6-4-17(12-18(20)24)22-26-23(27-32-22)28-10-8-16-11-15(3-5-19(16)28)13-25-9-7-21(29)30/h3-6,11-12,14,25H,7-10,13H2,1-2H3,(H,29,30) |
| InChIKey | XSQMRESKTHTVEK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|