C22H22ClN3O6S — CID 169197426
N-(5-chloro-2-ethenoxyphenyl)-2-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxyanilino]acetamide (PubChem CID 169197426) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is N-(5-chloro-2-ethenoxyphenyl)-2-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxyanilino]acetamide.
| Compound Name | N-(5-chloro-2-ethenoxyphenyl)-2-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxyanilino]acetamide |
|---|---|
| PubChem CID | 169197426 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | N-(5-chloro-2-ethenoxyphenyl)-2-[N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-methoxyanilino]acetamide |
| SMILES | C=COc1ccc(Cl)cc1NC(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C22H22ClN3O6S/c1-5-31-20-11-6-16(23)12-19(20)24-21(27)13-26(17-7-9-18(30-4)10-8-17)33(28,29)22-14(2)25-32-15(22)3/h5-12H,1,13H2,2-4H3,(H,24,27) |
| InChIKey | NTNROFZGEPSVDV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|