About methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate
methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate (PubChem CID 169198050) has the molecular formula C18H15F2NO3
and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate |
| PubChem CID | 169198050 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc2c(c1)-c1ccc(C)cc1C2(F)F |
| InChI | InChI=1S/C18H15F2NO3/c1-10-3-5-12-13-8-11(17(23)21-9-16(22)24-2)4-6-14(13)18(19,20)15(12)7-10/h3-8H,9H2,1-2H3,(H,21,23) |
| InChIKey | PPTCKEFZNYPAJL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate?
The IUPAC name of methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate (CID 169198050) is methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate.
What is the SMILES notation for methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate?
The canonical SMILES for methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate is COC(=O)CNC(=O)c1ccc2c(c1)-c1ccc(C)cc1C2(F)F.
What is the InChIKey of methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate?
The InChIKey is PPTCKEFZNYPAJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F2NO3/c1-10-3-5-12-13-8-11(17(23)21-9-16(22)24-2)4-6-14(13)18(19,20)15(12)7-10/h3-8H,9H2,1-2H3,(H,21,23).
What are the key properties of methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate?
methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate has a molecular weight of 331.32 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate is sourced from PubChem (CID 169198050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).