C18H15F2NO3 — CID 169198050
methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate (PubChem CID 169198050) has the molecular formula C18H15F2NO3 and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 169198050 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl 2-[(9,9-difluoro-7-methylfluorene-3-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc2c(c1)-c1ccc(C)cc1C2(F)F |
| InChI | InChI=1S/C18H15F2NO3/c1-10-3-5-12-13-8-11(17(23)21-9-16(22)24-2)4-6-14(13)18(19,20)15(12)7-10/h3-8H,9H2,1-2H3,(H,21,23) |
| InChIKey | PPTCKEFZNYPAJL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |