C23H20F2N2O4 — CID 170296825
methyl (2S)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylidenepyrrolidine-2-carboxylate (PubChem CID 170296825) has the molecular formula C23H20F2N2O4 and a molecular weight of 426.42 g/mol. Its IUPAC name is methyl (2S)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylidenepyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylidenepyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170296825 |
| Molecular Formula | C23H20F2N2O4 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | methyl (2S)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-methylidenepyrrolidine-2-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)OC)N(C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)C1 |
| InChI | InChI=1S/C23H20F2N2O4/c1-13-9-19(22(30)31-2)27(12-13)20(28)11-26-21(29)14-7-8-18-16(10-14)15-5-3-4-6-17(15)23(18,24)25/h3-8,10,19H,1,9,11-12H2,2H3,(H,26,29)/t19-/m0/s1 |
| InChIKey | VIOMEUZBQHTBDP-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|