C25H29F2N5O3 — CID 170298376
N-[2-[(2S,4R)-4-[(dimethylamino)methyl]-2-(hydrazinecarbonyl)-4-methylpyrrolidin-1-yl]-2-oxoethyl]-9,9-difluorofluorene-3-carboxamide (PubChem CID 170298376) has the molecular formula C25H29F2N5O3 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-[2-[(2S,4R)-4-[(dimethylamino)methyl]-2-(hydrazinecarbonyl)-4-methylpyrrolidin-1-yl]-2-oxoethyl]-9,9-difluorofluorene-3-carboxamide.
| Compound Name | N-[2-[(2S,4R)-4-[(dimethylamino)methyl]-2-(hydrazinecarbonyl)-4-methylpyrrolidin-1-yl]-2-oxoethyl]-9,9-difluorofluorene-3-carboxamide |
|---|---|
| PubChem CID | 170298376 |
| Molecular Formula | C25H29F2N5O3 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N-[2-[(2S,4R)-4-[(dimethylamino)methyl]-2-(hydrazinecarbonyl)-4-methylpyrrolidin-1-yl]-2-oxoethyl]-9,9-difluorofluorene-3-carboxamide |
| SMILES | CN(C)C[C@@]1(C)C[C@@H](C(=O)NN)N(C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)C1 |
| InChI | InChI=1S/C25H29F2N5O3/c1-24(13-31(2)3)11-20(23(35)30-28)32(14-24)21(33)12-29-22(34)15-8-9-19-17(10-15)16-6-4-5-7-18(16)25(19,26)27/h4-10,20H,11-14,28H2,1-3H3,(H,29,34)(H,30,35)/t20-,24+/m0/s1 |
| InChIKey | INJUAWUKGLPFGQ-GBXCKJPGSA-N |
| XLogP | 1.70 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|