C29H24F3N5O4 — CID 169198889
benzyl (2S,4R)-4-(azidomethyl)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-fluoropyrrolidine-2-carboxylate (PubChem CID 169198889) has the molecular formula C29H24F3N5O4 and a molecular weight of 563.54 g/mol. Its IUPAC name is benzyl (2S,4R)-4-(azidomethyl)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-fluoropyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S,4R)-4-(azidomethyl)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-fluoropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 169198889 |
| Molecular Formula | C29H24F3N5O4 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | benzyl (2S,4R)-4-(azidomethyl)-1-[2-[(9,9-difluorofluorene-3-carbonyl)amino]acetyl]-4-fluoropyrrolidine-2-carboxylate |
| SMILES | [N-]=[N+]=NC[C@@]1(F)C[C@@H](C(=O)OCc2ccccc2)N(C(=O)CNC(=O)c2ccc3c(c2)-c2ccccc2C3(F)F)C1 |
| InChI | InChI=1S/C29H24F3N5O4/c30-28(16-35-36-33)13-24(27(40)41-15-18-6-2-1-3-7-18)37(17-28)25(38)14-34-26(39)19-10-11-23-21(12-19)20-8-4-5-9-22(20)29(23,31)32/h1-12,24H,13-17H2,(H,34,39)/t24-,28-/m0/s1 |
| InChIKey | FSBLDGACMZGTEK-CUBQBAPOSA-N |
| XLogP | 4.90 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|