C6H11NO2 — CID 169199001
6-methyl-1,3-dioxa-7-azaspiro[3.4]octane (PubChem CID 169199001) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 6-methyl-1,3-dioxa-7-azaspiro[3.4]octane.
| Compound Name | 6-methyl-1,3-dioxa-7-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 169199001 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 6-methyl-1,3-dioxa-7-azaspiro[3.4]octane |
| SMILES | CC1CC2(CN1)OCO2 |
| InChI | InChI=1S/C6H11NO2/c1-5-2-6(3-7-5)8-4-9-6/h5,7H,2-4H2,1H3 |
| InChIKey | DPHIFEBISGFTFW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |