C27H28F2N6O5S — CID 169199586
N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[4-fluoro-5-(4-fluorophenyl)-2-pyridinyl]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;formamide (PubChem CID 169199586) has the molecular formula C27H28F2N6O5S and a molecular weight of 586.62 g/mol. Its IUPAC name is N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[4-fluoro-5-(4-fluorophenyl)-2-pyridinyl]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;formamide.
| Compound Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[4-fluoro-5-(4-fluorophenyl)-2-pyridinyl]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;formamide |
|---|---|
| PubChem CID | 169199586 |
| Molecular Formula | C27H28F2N6O5S |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-[2-[4-fluoro-5-(4-fluorophenyl)-2-pyridinyl]acetyl]-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;formamide |
| SMILES | NC=O.[H]/N=C(\N)c1csc(CNC(=O)C2CC3(CN2C(=O)Cc2cc(F)c(-c4ccc(F)cc4)cn2)OCCO3)c1 |
| InChI | InChI=1S/C26H25F2N5O4S.CH3NO/c27-17-3-1-15(2-4-17)20-12-31-18(8-21(20)28)9-23(34)33-14-26(36-5-6-37-26)10-22(33)25(35)32-11-19-7-16(13-38-19)24(29)30;2-1-3/h1-4,7-8,12-13,22H,5-6,9-11,14H2,(H3,29,30)(H,32,35);1H,(H2,2,3) |
| InChIKey | QZOPXDYRJBOALM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 173.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|