C29H32FN5O5S — CID 169198744
N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-(2-formamidoacetyl)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;2-fluoro-4-methyl-1-phenylbenzene (PubChem CID 169198744) has the molecular formula C29H32FN5O5S and a molecular weight of 581.67 g/mol. Its IUPAC name is N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-(2-formamidoacetyl)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;2-fluoro-4-methyl-1-phenylbenzene.
| Compound Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-(2-formamidoacetyl)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;2-fluoro-4-methyl-1-phenylbenzene |
|---|---|
| PubChem CID | 169198744 |
| Molecular Formula | C29H32FN5O5S |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | N-[(4-carbamimidoylthiophen-2-yl)methyl]-7-(2-formamidoacetyl)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxamide;2-fluoro-4-methyl-1-phenylbenzene |
| SMILES | Cc1ccc(-c2ccccc2)c(F)c1.[H]/N=C(\N)c1csc(CNC(=O)C2CC3(CN2C(=O)CNC=O)OCCO3)c1 |
| InChI | InChI=1S/C16H21N5O5S.C13H11F/c17-14(18)10-3-11(27-7-10)5-20-15(24)12-4-16(25-1-2-26-16)8-21(12)13(23)6-19-9-22;1-10-7-8-12(13(14)9-10)11-5-3-2-4-6-11/h3,7,9,12H,1-2,4-6,8H2,(H3,17,18)(H,19,22)(H,20,24);2-9H,1H3 |
| InChIKey | JTLUGOCKKLSLCL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|