C15H22N2 — CID 169200028
N-[(1Z)-2,3-dimethyl-1-pyridin-3-ylbuta-1,3-dienyl]ethanimine;ethane (PubChem CID 169200028) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-[(1Z)-2,3-dimethyl-1-pyridin-3-ylbuta-1,3-dienyl]ethanimine;ethane.
| Compound Name | N-[(1Z)-2,3-dimethyl-1-pyridin-3-ylbuta-1,3-dienyl]ethanimine;ethane |
|---|---|
| PubChem CID | 169200028 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-[(1Z)-2,3-dimethyl-1-pyridin-3-ylbuta-1,3-dienyl]ethanimine;ethane |
| SMILES | C=C(C)/C(C)=C(\N=C\C)c1cccnc1.CC |
| InChI | InChI=1S/C13H16N2.C2H6/c1-5-15-13(11(4)10(2)3)12-7-6-8-14-9-12;1-2/h5-9H,2H2,1,3-4H3;1-2H3/b13-11-,15-5+; |
| InChIKey | ZCUVKZYWGZSUIH-MAJUBXOBSA-N |
| XLogP | 4.51 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|