C20H23FN4O4S — CID 16920116
1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]urea (PubChem CID 16920116) has the molecular formula C20H23FN4O4S and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 16920116 |
| Molecular Formula | C20H23FN4O4S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]methyl]urea |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)NCC2CC(=O)N(c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C20H23FN4O4S/c1-24(2)30(28,29)18-9-5-16(6-10-18)23-20(27)22-12-14-11-19(26)25(13-14)17-7-3-15(21)4-8-17/h3-10,14H,11-13H2,1-2H3,(H2,22,23,27) |
| InChIKey | CLVJPHDOEVAPAB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |