C21H26N4O4S — CID 16920224
1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]urea (PubChem CID 16920224) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 16920224 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-[[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]methyl]urea |
| SMILES | Cc1ccc(N2CC(CNC(=O)Nc3ccc(S(=O)(=O)N(C)C)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-15-4-8-18(9-5-15)25-14-16(12-20(25)26)13-22-21(27)23-17-6-10-19(11-7-17)30(28,29)24(2)3/h4-11,16H,12-14H2,1-3H3,(H2,22,23,27) |
| InChIKey | UVRGECTVKFJZFR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |