C32H31F2N5O5 — CID 169201182
(3S)-3-[(3R)-3',3'-difluoro-1'-[[3-[1-(oxetan-3-yl)pyrazol-4-yl]phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 169201182) has the molecular formula C32H31F2N5O5 and a molecular weight of 603.63 g/mol. Its IUPAC name is (3S)-3-[(3R)-3',3'-difluoro-1'-[[3-[1-(oxetan-3-yl)pyrazol-4-yl]phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[(3R)-3',3'-difluoro-1'-[[3-[1-(oxetan-3-yl)pyrazol-4-yl]phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169201182 |
| Molecular Formula | C32H31F2N5O5 |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | (3S)-3-[(3R)-3',3'-difluoro-1'-[[3-[1-(oxetan-3-yl)pyrazol-4-yl]phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3c(ccc4c3OC[C@@]43CCN(Cc4cccc(-c5cnn(C6COC6)c5)c4)CC3(F)F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H31F2N5O5/c33-32(34)17-37(12-19-2-1-3-20(10-19)21-11-35-39(13-21)22-15-43-16-22)9-8-31(32)18-44-28-24-14-38(26-6-7-27(40)36-29(26)41)30(42)23(24)4-5-25(28)31/h1-5,10-11,13,22,26H,6-9,12,14-18H2,(H,36,40,41)/t26-,31-/m0/s1 |
| InChIKey | RHDIVMCHRCZEIJ-HVNZXBJASA-N |
| XLogP | 3.05 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|