C30H29F2N5O4 — CID 170169178
3-[3',3'-difluoro-1'-[[3-(5-methyl-1H-pyrazol-4-yl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 170169178) has the molecular formula C30H29F2N5O4 and a molecular weight of 561.59 g/mol. Its IUPAC name is 3-[3',3'-difluoro-1'-[[3-(5-methyl-1H-pyrazol-4-yl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | 3-[3',3'-difluoro-1'-[[3-(5-methyl-1H-pyrazol-4-yl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170169178 |
| Molecular Formula | C30H29F2N5O4 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 3-[3',3'-difluoro-1'-[[3-(5-methyl-1H-pyrazol-4-yl)phenyl]methyl]-6-oxospiro[2,8-dihydrofuro[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | Cc1[nH]ncc1-c1cccc(CN2CCC3(COc4c3ccc3c4CN(C4CCC(=O)NC4=O)C3=O)C(F)(F)C2)c1 |
| InChI | InChI=1S/C30H29F2N5O4/c1-17-21(12-33-35-17)19-4-2-3-18(11-19)13-36-10-9-29(30(31,32)15-36)16-41-26-22-14-37(24-7-8-25(38)34-27(24)39)28(40)20(22)5-6-23(26)29/h2-6,11-12,24H,7-10,13-16H2,1H3,(H,33,35)(H,34,38,39) |
| InChIKey | AVQLUWNVKJMKMB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|