C14H20N2 — CID 169203234
N,N-diethyl-2-indolizin-1-ylethanamine (PubChem CID 169203234) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N,N-diethyl-2-indolizin-1-ylethanamine.
| Compound Name | N,N-diethyl-2-indolizin-1-ylethanamine |
|---|---|
| PubChem CID | 169203234 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N,N-diethyl-2-indolizin-1-ylethanamine |
| SMILES | CCN(CC)CCc1ccn2ccccc12 |
| InChI | InChI=1S/C14H20N2/c1-3-15(4-2)11-8-13-9-12-16-10-6-5-7-14(13)16/h5-7,9-10,12H,3-4,8,11H2,1-2H3 |
| InChIKey | PQNHENSQNHRFHB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 7.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |