About indolizin-1-ylmethanol;pyridine
indolizin-1-ylmethanol;pyridine (PubChem CID 174415152) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is indolizin-1-ylmethanol;pyridine.
Molecular Properties
| Compound Name | indolizin-1-ylmethanol;pyridine |
| PubChem CID | 174415152 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | indolizin-1-ylmethanol;pyridine |
| SMILES | OCc1ccn2ccccc12.c1ccncc1 |
| InChI | InChI=1S/C9H9NO.C5H5N/c11-7-8-4-6-10-5-2-1-3-9(8)10;1-2-4-6-5-3-1/h1-6,11H,7H2;1-5H |
| InChIKey | MQBFJDXBHFIFHA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze indolizin-1-ylmethanol;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizin-1-ylmethanol;pyridine?
The IUPAC name of indolizin-1-ylmethanol;pyridine (CID 174415152) is indolizin-1-ylmethanol;pyridine.
What is the SMILES notation for indolizin-1-ylmethanol;pyridine?
The canonical SMILES for indolizin-1-ylmethanol;pyridine is OCc1ccn2ccccc12.c1ccncc1.
What is the InChIKey of indolizin-1-ylmethanol;pyridine?
The InChIKey is MQBFJDXBHFIFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO.C5H5N/c11-7-8-4-6-10-5-2-1-3-9(8)10;1-2-4-6-5-3-1/h1-6,11H,7H2;1-5H.
What are the key properties of indolizin-1-ylmethanol;pyridine?
indolizin-1-ylmethanol;pyridine has a molecular weight of 226.28 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for indolizin-1-ylmethanol;pyridine is sourced from PubChem (CID 174415152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).