About 1,1'-biphenyl;indolizin-1-ol
1,1'-biphenyl;indolizin-1-ol (PubChem CID 22905672) has the molecular formula C20H17NO
and a molecular weight of 287.36 g/mol. Its IUPAC name is 1,1'-biphenyl;indolizin-1-ol.
Molecular Properties
| Compound Name | 1,1'-biphenyl;indolizin-1-ol |
| PubChem CID | 22905672 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1,1'-biphenyl;indolizin-1-ol |
| SMILES | Oc1ccn2ccccc12.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H7NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;10-8-4-6-9-5-2-1-3-7(8)9/h1-10H;1-6,10H |
| InChIKey | NMKPRCMHDALSOX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;indolizin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;indolizin-1-ol?
The IUPAC name of 1,1'-biphenyl;indolizin-1-ol (CID 22905672) is 1,1'-biphenyl;indolizin-1-ol.
What is the SMILES notation for 1,1'-biphenyl;indolizin-1-ol?
The canonical SMILES for 1,1'-biphenyl;indolizin-1-ol is Oc1ccn2ccccc12.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;indolizin-1-ol?
The InChIKey is NMKPRCMHDALSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C8H7NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;10-8-4-6-9-5-2-1-3-7(8)9/h1-10H;1-6,10H.
What are the key properties of 1,1'-biphenyl;indolizin-1-ol?
1,1'-biphenyl;indolizin-1-ol has a molecular weight of 287.36 g/mol, XLogP of 5.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;indolizin-1-ol is sourced from PubChem (CID 22905672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).